ChemNet > CAS > 1455-18-1 3-Methylbenzo[b]thiophene
1455-18-1 3-Methylbenzo[b]thiophene
| Ürün Adı |
3-Methylbenzo[b]thiophene |
| ingilizce adı |
3-Methylbenzo[b]thiophene; Methylbenzobthiophene; 3-Methylthianaphthene; 3-methyl-1-benzothiophene |
| Moleküler Formülü |
C9H8S |
| Molekül Ağırlığı |
148.2248 |
| InChI |
InChI=1/C9H8S/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6H,1H3 |
| CAS kayıt numarası |
1455-18-1 |
| EINECS |
215-934-6 |
| Moleküler Yapısı |
![1455-18-1 3-Methylbenzo[b]thiophene](https://images-a.chemnet.com/suppliers/chembase/485/136485.gif)
|
| Yoğunluk |
1.146g/cm3 |
| Kaynama noktası |
243°C at 760 mmHg |
| Kırılma indisi |
1.652 |
| Alevlenme noktası |
72.4°C |
| Buhar basıncı |
0.0514mmHg at 25°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
